C22H52O10Si6 — CID 87900166
prop-2-enoyl 2,3-dihydroxy-2-[[methyl-bis(trimethylsilyloxy)silyl]oxy-bis(trimethylsilyloxy)silyl]hexanoate (PubChem CID 87900166) has the molecular formula C22H52O10Si6 and a molecular weight of 645.16 g/mol. Its IUPAC name is prop-2-enoyl 2,3-dihydroxy-2-[[methyl-bis(trimethylsilyloxy)silyl]oxy-bis(trimethylsilyloxy)silyl]hexanoate.
| Compound Name | prop-2-enoyl 2,3-dihydroxy-2-[[methyl-bis(trimethylsilyloxy)silyl]oxy-bis(trimethylsilyloxy)silyl]hexanoate |
|---|---|
| PubChem CID | 87900166 |
| Molecular Formula | C22H52O10Si6 |
| Molecular Weight | 645.16 g/mol |
| Exact Mass | 644.22 |
| IUPAC Name | prop-2-enoyl 2,3-dihydroxy-2-[[methyl-bis(trimethylsilyloxy)silyl]oxy-bis(trimethylsilyloxy)silyl]hexanoate |
| SMILES | C=CC(=O)OC(=O)C(O)(C(O)CCC)[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C22H52O10Si6/c1-16-18-19(23)22(26,21(25)27-20(24)17-2)38(30-35(9,10)11,31-36(12,13)14)32-37(15,28-33(3,4)5)29-34(6,7)8/h17,19,23,26H,2,16,18H2,1,3-15H3 |
| InChIKey | JBVULOVANCGDHX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.16 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|