About prop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate
prop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate (PubChem CID 87900222) has the molecular formula C16H34O7Si3
and a molecular weight of 422.70 g/mol. Its IUPAC name is prop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate.
Molecular Properties
| Compound Name | prop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate |
| PubChem CID | 87900222 |
| Molecular Formula | C16H34O7Si3 |
| Molecular Weight | 422.70 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | prop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate |
| SMILES | C=CC(=O)OC(=O)C(O)(C(O)CCC)[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H34O7Si3/c1-10-12-13(17)16(20,15(19)21-14(18)11-2)26(9,22-24(3,4)5)23-25(6,7)8/h11,13,17,20H,2,10,12H2,1,3-9H3 |
| InChIKey | AEJZRPMRYDTQQS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.70 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate?
The IUPAC name of prop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate (CID 87900222) is prop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate.
What is the SMILES notation for prop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate?
The canonical SMILES for prop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate is C=CC(=O)OC(=O)C(O)(C(O)CCC)[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C.
What is the InChIKey of prop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate?
The InChIKey is AEJZRPMRYDTQQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O7Si3/c1-10-12-13(17)16(20,15(19)21-14(18)11-2)26(9,22-24(3,4)5)23-25(6,7)8/h11,13,17,20H,2,10,12H2,1,3-9H3.
What are the key properties of prop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate?
prop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate has a molecular weight of 422.70 g/mol, XLogP of 2.45, 10 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate is sourced from PubChem (CID 87900222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).