C18H19Cl2N9O3S2 — CID 87900300
[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]cyanamide;(NE)-N-[3-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-methyl-1,3,5-oxadiazinan-4-ylidene]nitramide (PubChem CID 87900300) has the molecular formula C18H19Cl2N9O3S2 and a molecular weight of 544.45 g/mol. Its IUPAC name is [3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]cyanamide;(NE)-N-[3-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-methyl-1,3,5-oxadiazinan-4-ylidene]nitramide.
| Compound Name | [3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]cyanamide;(NE)-N-[3-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-methyl-1,3,5-oxadiazinan-4-ylidene]nitramide |
|---|---|
| PubChem CID | 87900300 |
| Molecular Formula | C18H19Cl2N9O3S2 |
| Molecular Weight | 544.45 g/mol |
| Exact Mass | 543.04 |
| IUPAC Name | [3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]cyanamide;(NE)-N-[3-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-methyl-1,3,5-oxadiazinan-4-ylidene]nitramide |
| SMILES | CN1COCN(Cc2cnc(Cl)s2)/C1=N/[N+](=O)[O-].N#C/N=C1\SCCN1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H9ClN4S.C8H10ClN5O3S/c11-9-2-1-8(5-13-9)6-15-3-4-16-10(15)14-7-12;1-12-4-17-5-13(8(12)11-14(15)16)3-6-2-10-7(9)18-6/h1-2,5H,3-4,6H2;2H,3-5H2,1H3/b14-10-;11-8+ |
| InChIKey | WQDZZFNGZNWGJU-HFHOCHGJSA-N |
| XLogP | 3.14 |
| TPSA | 136.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|