About 3-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-2-tert-butyl-4-phenylpyrrolidine-1-carboxylic acid
3-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-2-tert-butyl-4-phenylpyrrolidine-1-carboxylic acid (PubChem CID 87900326) has the molecular formula C24H25F6NO3
and a molecular weight of 489.46 g/mol. Its IUPAC name is 3-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-2-tert-butyl-4-phenylpyrrolidine-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-2-tert-butyl-4-phenylpyrrolidine-1-carboxylic acid |
| PubChem CID | 87900326 |
| Molecular Formula | C24H25F6NO3 |
| Molecular Weight | 489.46 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 3-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-2-tert-butyl-4-phenylpyrrolidine-1-carboxylic acid |
| SMILES | CC(C)(C)C1C(COc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(c2ccccc2)CN1C(=O)O |
| InChI | InChI=1S/C24H25F6NO3/c1-22(2,3)20-19(18(12-31(20)21(32)33)14-7-5-4-6-8-14)13-34-17-10-15(23(25,26)27)9-16(11-17)24(28,29)30/h4-11,18-20H,12-13H2,1-3H3,(H,32,33) |
| InChIKey | IOJIGNPLIABUTF-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.46 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-2-tert-butyl-4-phenylpyrrolidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-2-tert-butyl-4-phenylpyrrolidine-1-carboxylic acid?
The IUPAC name of 3-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-2-tert-butyl-4-phenylpyrrolidine-1-carboxylic acid (CID 87900326) is 3-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-2-tert-butyl-4-phenylpyrrolidine-1-carboxylic acid.
What is the SMILES notation for 3-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-2-tert-butyl-4-phenylpyrrolidine-1-carboxylic acid?
The canonical SMILES for 3-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-2-tert-butyl-4-phenylpyrrolidine-1-carboxylic acid is CC(C)(C)C1C(COc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(c2ccccc2)CN1C(=O)O.
What is the InChIKey of 3-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-2-tert-butyl-4-phenylpyrrolidine-1-carboxylic acid?
The InChIKey is IOJIGNPLIABUTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25F6NO3/c1-22(2,3)20-19(18(12-31(20)21(32)33)14-7-5-4-6-8-14)13-34-17-10-15(23(25,26)27)9-16(11-17)24(28,29)30/h4-11,18-20H,12-13H2,1-3H3,(H,32,33).
What are the key properties of 3-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-2-tert-butyl-4-phenylpyrrolidine-1-carboxylic acid?
3-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-2-tert-butyl-4-phenylpyrrolidine-1-carboxylic acid has a molecular weight of 489.46 g/mol, XLogP of 6.91, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-2-tert-butyl-4-phenylpyrrolidine-1-carboxylic acid is sourced from PubChem (CID 87900326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).