(3R)-3-amino-3-phenylpropanoic acid;methanesulfonic acid

C10H15NO5S — CID 87900954

IUPAC(3R)-3-amino-3-phenylpropanoic acid;methanesulfonic acid
SMILESCS(=O)(=O)O.N[C@H](CC(=O)O)c1ccccc1
InChIInChI=1S/C9H11NO2.CH4O3S/c10-8(6-9(11)12)7-4-2-1-3-5-7;1-5(2,3)4/h1-5,8H,6,10H2,(H,11,12);1H3,(H,2,3,4)/t8-;/m1./s1
InChIKeyGHORMGBYSXTMQD-DDWIOCJRSA-N
MW261.30 g/mol
LogP0.67
Rot. Bonds3

About (3R)-3-amino-3-phenylpropanoic acid;methanesulfonic acid

(3R)-3-amino-3-phenylpropanoic acid;methanesulfonic acid (PubChem CID 87900954) has the molecular formula C10H15NO5S and a molecular weight of 261.30 g/mol. Its IUPAC name is (3R)-3-amino-3-phenylpropanoic acid;methanesulfonic acid.

Molecular Properties

Compound Name(3R)-3-amino-3-phenylpropanoic acid;methanesulfonic acid
PubChem CID87900954
Molecular FormulaC10H15NO5S
Molecular Weight261.30 g/mol
Exact Mass261.07
IUPAC Name(3R)-3-amino-3-phenylpropanoic acid;methanesulfonic acid
SMILESCS(=O)(=O)O.N[C@H](CC(=O)O)c1ccccc1
InChIInChI=1S/C9H11NO2.CH4O3S/c10-8(6-9(11)12)7-4-2-1-3-5-7;1-5(2,3)4/h1-5,8H,6,10H2,(H,11,12);1H3,(H,2,3,4)/t8-;/m1./s1
InChIKeyGHORMGBYSXTMQD-DDWIOCJRSA-N
XLogP0.67
TPSA117.69 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.30
LogP ≤ 50.67
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze (3R)-3-amino-3-phenylpropanoic acid;methanesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R)-3-amino-3-phenylpropanoic acid;methanesulfonic acid?
The IUPAC name of (3R)-3-amino-3-phenylpropanoic acid;methanesulfonic acid (CID 87900954) is (3R)-3-amino-3-phenylpropanoic acid;methanesulfonic acid.
What is the SMILES notation for (3R)-3-amino-3-phenylpropanoic acid;methanesulfonic acid?
The canonical SMILES for (3R)-3-amino-3-phenylpropanoic acid;methanesulfonic acid is CS(=O)(=O)O.N[C@H](CC(=O)O)c1ccccc1.
What is the InChIKey of (3R)-3-amino-3-phenylpropanoic acid;methanesulfonic acid?
The InChIKey is GHORMGBYSXTMQD-DDWIOCJRSA-N. The full InChI is InChI=1S/C9H11NO2.CH4O3S/c10-8(6-9(11)12)7-4-2-1-3-5-7;1-5(2,3)4/h1-5,8H,6,10H2,(H,11,12);1H3,(H,2,3,4)/t8-;/m1./s1.
What are the key properties of (3R)-3-amino-3-phenylpropanoic acid;methanesulfonic acid?
(3R)-3-amino-3-phenylpropanoic acid;methanesulfonic acid has a molecular weight of 261.30 g/mol, XLogP of 0.67, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-amino-3-phenylpropanoic acid;methanesulfonic acid is sourced from PubChem (CID 87900954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).