C31H41NO6 — CID 87900996
(3S,7S,10R,11R,12S)-7,11-dihydroxy-8,8,12,16-tetramethyl-10-prop-2-enyl-3-quinolin-7-yl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 87900996) has the molecular formula C31H41NO6 and a molecular weight of 523.67 g/mol. Its IUPAC name is (3S,7S,10R,11R,12S)-7,11-dihydroxy-8,8,12,16-tetramethyl-10-prop-2-enyl-3-quinolin-7-yl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (3S,7S,10R,11R,12S)-7,11-dihydroxy-8,8,12,16-tetramethyl-10-prop-2-enyl-3-quinolin-7-yl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 87900996 |
| Molecular Formula | C31H41NO6 |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | (3S,7S,10R,11R,12S)-7,11-dihydroxy-8,8,12,16-tetramethyl-10-prop-2-enyl-3-quinolin-7-yl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C=CC[C@H]1C(=O)C(C)(C)[C@@H](O)CC(=O)O[C@H](c2ccc3cccnc3c2)CC2OC2(C)CCC[C@H](C)[C@H]1O |
| InChI | InChI=1S/C31H41NO6/c1-6-9-22-28(35)19(2)10-7-14-31(5)26(38-31)17-24(21-13-12-20-11-8-15-32-23(20)16-21)37-27(34)18-25(33)30(3,4)29(22)36/h6,8,11-13,15-16,19,22,24-26,28,33,35H,1,7,9-10,14,17-18H2,2-5H3/t19-,22+,24-,25-,26?,28+,31?/m0/s1 |
| InChIKey | QKAGTQDZXQAPNQ-JQUAHPGUSA-N |
| XLogP | 5.09 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|