C28H38N2O2 — CID 87902124
(2E,4E,6E,8E)-N,3,7-trimethyl-N-(2-pyridin-2-yloxyethyl)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide (PubChem CID 87902124) has the molecular formula C28H38N2O2 and a molecular weight of 434.62 g/mol. Its IUPAC name is (2E,4E,6E,8E)-N,3,7-trimethyl-N-(2-pyridin-2-yloxyethyl)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide.
| Compound Name | (2E,4E,6E,8E)-N,3,7-trimethyl-N-(2-pyridin-2-yloxyethyl)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 87902124 |
| Molecular Formula | C28H38N2O2 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | (2E,4E,6E,8E)-N,3,7-trimethyl-N-(2-pyridin-2-yloxyethyl)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)N(C)CCOc2ccccn2)C(C)(C)CCC1 |
| InChI | InChI=1S/C28H38N2O2/c1-22(15-16-25-24(3)13-10-17-28(25,4)5)11-9-12-23(2)21-27(31)30(6)19-20-32-26-14-7-8-18-29-26/h7-9,11-12,14-16,18,21H,10,13,17,19-20H2,1-6H3/b12-9+,16-15+,22-11+,23-21+ |
| InChIKey | VYGRRFRTODOTHQ-WXCJXHHZSA-N |
| XLogP | 6.45 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|