About 1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-ol perchlorate
1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-ol perchlorate (PubChem CID 87902192) has the molecular formula C16H22ClN5O5
and a molecular weight of 399.84 g/mol. Its IUPAC name is 1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-ol perchlorate.
Molecular Properties
| Compound Name | 1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-ol perchlorate |
| PubChem CID | 87902192 |
| Molecular Formula | C16H22ClN5O5 |
| Molecular Weight | 399.84 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-ol perchlorate |
| SMILES | Cn1cc[n+](C)c1/N=N/c1ccc(N2CCC(O)CC2)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C16H22N5O.ClHO4/c1-19-11-12-20(2)16(19)18-17-13-3-5-14(6-4-13)21-9-7-15(22)8-10-21;2-1(3,4)5/h3-6,11-12,15,22H,7-10H2,1-2H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | MEJCVEAHNNXFMB-UHFFFAOYSA-M |
| XLogP | -2.53 |
| TPSA | 149.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.84 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-ol perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-ol perchlorate?
The IUPAC name of 1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-ol perchlorate (CID 87902192) is 1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-ol perchlorate.
What is the SMILES notation for 1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-ol perchlorate?
The canonical SMILES for 1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-ol perchlorate is Cn1cc[n+](C)c1/N=N/c1ccc(N2CCC(O)CC2)cc1.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of 1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-ol perchlorate?
The InChIKey is MEJCVEAHNNXFMB-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H22N5O.ClHO4/c1-19-11-12-20(2)16(19)18-17-13-3-5-14(6-4-13)21-9-7-15(22)8-10-21;2-1(3,4)5/h3-6,11-12,15,22H,7-10H2,1-2H3;(H,2,3,4,5)/q+1;/p-1.
What are the key properties of 1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-ol perchlorate?
1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-ol perchlorate has a molecular weight of 399.84 g/mol, XLogP of -2.53, 3 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-ol perchlorate is sourced from PubChem (CID 87902192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).