About [1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-yl] perchlorate
[1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-yl] perchlorate (PubChem CID 87902195) has the molecular formula C16H21ClN5O4+
and a molecular weight of 382.83 g/mol. Its IUPAC name is [1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-yl] perchlorate.
Molecular Properties
| Compound Name | [1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-yl] perchlorate |
| PubChem CID | 87902195 |
| Molecular Formula | C16H21ClN5O4+ |
| Molecular Weight | 382.83 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | [1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-yl] perchlorate |
| SMILES | Cn1cc[n+](C)c1/N=N/c1ccc(N2CCC(O[Cl+3]([O-])([O-])[O-])CC2)cc1 |
| InChI | InChI=1S/C16H21ClN5O4/c1-20-11-12-21(2)16(20)19-18-13-3-5-14(6-4-13)22-9-7-15(8-10-22)26-17(23,24)25/h3-6,11-12,15H,7-10H2,1-2H3/q+1 |
| InChIKey | HAMWULRBAFDNAK-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 115.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.83 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-yl] perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-yl] perchlorate?
The IUPAC name of [1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-yl] perchlorate (CID 87902195) is [1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-yl] perchlorate.
What is the SMILES notation for [1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-yl] perchlorate?
The canonical SMILES for [1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-yl] perchlorate is Cn1cc[n+](C)c1/N=N/c1ccc(N2CCC(O[Cl+3]([O-])([O-])[O-])CC2)cc1.
What is the InChIKey of [1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-yl] perchlorate?
The InChIKey is HAMWULRBAFDNAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21ClN5O4/c1-20-11-12-21(2)16(20)19-18-13-3-5-14(6-4-13)22-9-7-15(8-10-22)26-17(23,24)25/h3-6,11-12,15H,7-10H2,1-2H3/q+1.
What are the key properties of [1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-yl] perchlorate?
[1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-yl] perchlorate has a molecular weight of 382.83 g/mol, XLogP of -0.85, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperidin-4-yl] perchlorate is sourced from PubChem (CID 87902195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).