C18H14F17O3S2+ — CID 87902299
[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyloxy)-3,5-dimethylphenyl]-dimethylsulfanium (PubChem CID 87902299) has the molecular formula C18H14F17O3S2+ and a molecular weight of 665.41 g/mol. Its IUPAC name is [4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyloxy)-3,5-dimethylphenyl]-dimethylsulfanium.
| Compound Name | [4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyloxy)-3,5-dimethylphenyl]-dimethylsulfanium |
|---|---|
| PubChem CID | 87902299 |
| Molecular Formula | C18H14F17O3S2+ |
| Molecular Weight | 665.41 g/mol |
| Exact Mass | 665.01 |
| IUPAC Name | [4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyloxy)-3,5-dimethylphenyl]-dimethylsulfanium |
| SMILES | Cc1cc([S+](C)C)cc(C)c1OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H14F17O3S2/c1-7-5-9(39(3)4)6-8(2)10(7)38-40(36,37)18(34,35)16(29,30)14(25,26)12(21,22)11(19,20)13(23,24)15(27,28)17(31,32)33/h5-6H,1-4H3/q+1 |
| InChIKey | KPABXZPVIJLVRT-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.41 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|