C26H16F34O2 — CID 87902314
(1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,14,14,15,15,16,16,17,17,18,18,19,19,20,20,21,21,21-tetratriacontafluoro-11-methylhenicosan-11-yl) 2-methylprop-2-enoate (PubChem CID 87902314) has the molecular formula C26H16F34O2 and a molecular weight of 1006.34 g/mol. Its IUPAC name is (1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,14,14,15,15,16,16,17,17,18,18,19,19,20,20,21,21,21-tetratriacontafluoro-11-methylhenicosan-11-yl) 2-methylprop-2-enoate.
| Compound Name | (1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,14,14,15,15,16,16,17,17,18,18,19,19,20,20,21,21,21-tetratriacontafluoro-11-methylhenicosan-11-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87902314 |
| Molecular Formula | C26H16F34O2 |
| Molecular Weight | 1006.34 g/mol |
| Exact Mass | 1006.06 |
| IUPAC Name | (1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,14,14,15,15,16,16,17,17,18,18,19,19,20,20,21,21,21-tetratriacontafluoro-11-methylhenicosan-11-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C26H16F34O2/c1-8(2)9(61)62-10(3,4-6-11(27,28)13(31,32)15(35,36)17(39,40)19(43,44)21(47,48)23(51,52)25(55,56)57)5-7-12(29,30)14(33,34)16(37,38)18(41,42)20(45,46)22(49,50)24(53,54)26(58,59)60/h1,4-7H2,2-3H3 |
| InChIKey | FLSMXADSXUNLST-UHFFFAOYSA-N |
| XLogP | 13.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1006.34 |
| LogP ≤ 5 | 13.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|