About 1-[(R)-cyclopenta-2,4-dien-1-ylsulfinyl]-4-methylbenzene;cyclopentane;iron
1-[(R)-cyclopenta-2,4-dien-1-ylsulfinyl]-4-methylbenzene;cyclopentane;iron (PubChem CID 87902787) has the molecular formula C17H16FeOS-6
and a molecular weight of 324.23 g/mol. Its IUPAC name is 1-[(R)-cyclopenta-2,4-dien-1-ylsulfinyl]-4-methylbenzene;cyclopentane;iron.
Molecular Properties
| Compound Name | 1-[(R)-cyclopenta-2,4-dien-1-ylsulfinyl]-4-methylbenzene;cyclopentane;iron |
| PubChem CID | 87902787 |
| Molecular Formula | C17H16FeOS-6 |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 1-[(R)-cyclopenta-2,4-dien-1-ylsulfinyl]-4-methylbenzene;cyclopentane;iron |
| SMILES | Cc1ccc([S@](=O)[c-]2cccc2)cc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C12H11OS.C5H5.Fe/c1-10-6-8-12(9-7-10)14(13)11-4-2-3-5-11;1-2-4-5-3-1;/h2-9H,1H3;1-5H;/q-1;-5;/t14-;;/m1../s1 |
| InChIKey | ITJLQXKXGXLXGX-FMOMHUKBSA-N |
| XLogP | 4.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-[(R)-cyclopenta-2,4-dien-1-ylsulfinyl]-4-methylbenzene;cyclopentane;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(R)-cyclopenta-2,4-dien-1-ylsulfinyl]-4-methylbenzene;cyclopentane;iron?
The IUPAC name of 1-[(R)-cyclopenta-2,4-dien-1-ylsulfinyl]-4-methylbenzene;cyclopentane;iron (CID 87902787) is 1-[(R)-cyclopenta-2,4-dien-1-ylsulfinyl]-4-methylbenzene;cyclopentane;iron.
What is the SMILES notation for 1-[(R)-cyclopenta-2,4-dien-1-ylsulfinyl]-4-methylbenzene;cyclopentane;iron?
The canonical SMILES for 1-[(R)-cyclopenta-2,4-dien-1-ylsulfinyl]-4-methylbenzene;cyclopentane;iron is Cc1ccc([S@](=O)[c-]2cccc2)cc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1.
What is the InChIKey of 1-[(R)-cyclopenta-2,4-dien-1-ylsulfinyl]-4-methylbenzene;cyclopentane;iron?
The InChIKey is ITJLQXKXGXLXGX-FMOMHUKBSA-N. The full InChI is InChI=1S/C12H11OS.C5H5.Fe/c1-10-6-8-12(9-7-10)14(13)11-4-2-3-5-11;1-2-4-5-3-1;/h2-9H,1H3;1-5H;/q-1;-5;/t14-;;/m1../s1.
What are the key properties of 1-[(R)-cyclopenta-2,4-dien-1-ylsulfinyl]-4-methylbenzene;cyclopentane;iron?
1-[(R)-cyclopenta-2,4-dien-1-ylsulfinyl]-4-methylbenzene;cyclopentane;iron has a molecular weight of 324.23 g/mol, XLogP of 4.28, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(R)-cyclopenta-2,4-dien-1-ylsulfinyl]-4-methylbenzene;cyclopentane;iron is sourced from PubChem (CID 87902787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).