About 3,6-dihydro-2H-pyrrolo[3,2-f]quinolin-5-ol
3,6-dihydro-2H-pyrrolo[3,2-f]quinolin-5-ol (PubChem CID 87902892) has the molecular formula C11H10N2O
and a molecular weight of 186.21 g/mol. Its IUPAC name is 3,6-dihydro-2H-pyrrolo[3,2-f]quinolin-5-ol.
Molecular Properties
| Compound Name | 3,6-dihydro-2H-pyrrolo[3,2-f]quinolin-5-ol |
| PubChem CID | 87902892 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 3,6-dihydro-2H-pyrrolo[3,2-f]quinolin-5-ol |
| SMILES | Oc1cc2c(c3c1NC=CC=3)=CCN2 |
| InChI | InChI=1S/C11H10N2O/c14-10-6-9-7(3-5-12-9)8-2-1-4-13-11(8)10/h1-4,6,12-14H,5H2 |
| InChIKey | BCCOHKWQPNIOGO-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dihydro-2H-pyrrolo[3,2-f]quinolin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dihydro-2H-pyrrolo[3,2-f]quinolin-5-ol?
The IUPAC name of 3,6-dihydro-2H-pyrrolo[3,2-f]quinolin-5-ol (CID 87902892) is 3,6-dihydro-2H-pyrrolo[3,2-f]quinolin-5-ol.
What is the SMILES notation for 3,6-dihydro-2H-pyrrolo[3,2-f]quinolin-5-ol?
The canonical SMILES for 3,6-dihydro-2H-pyrrolo[3,2-f]quinolin-5-ol is Oc1cc2c(c3c1NC=CC=3)=CCN2.
What is the InChIKey of 3,6-dihydro-2H-pyrrolo[3,2-f]quinolin-5-ol?
The InChIKey is BCCOHKWQPNIOGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O/c14-10-6-9-7(3-5-12-9)8-2-1-4-13-11(8)10/h1-4,6,12-14H,5H2.
What are the key properties of 3,6-dihydro-2H-pyrrolo[3,2-f]quinolin-5-ol?
3,6-dihydro-2H-pyrrolo[3,2-f]quinolin-5-ol has a molecular weight of 186.21 g/mol, XLogP of 0.32, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dihydro-2H-pyrrolo[3,2-f]quinolin-5-ol is sourced from PubChem (CID 87902892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).