About tetramethyl cyclopentane-1,1,2,2-tetracarboxylate
tetramethyl cyclopentane-1,1,2,2-tetracarboxylate (PubChem CID 879029) has the molecular formula C13H18O8
and a molecular weight of 302.28 g/mol. Its IUPAC name is tetramethyl cyclopentane-1,1,2,2-tetracarboxylate.
Molecular Properties
| Compound Name | tetramethyl cyclopentane-1,1,2,2-tetracarboxylate |
| PubChem CID | 879029 |
| Molecular Formula | C13H18O8 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | tetramethyl cyclopentane-1,1,2,2-tetracarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CCCC1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C13H18O8/c1-18-8(14)12(9(15)19-2)6-5-7-13(12,10(16)20-3)11(17)21-4/h5-7H2,1-4H3 |
| InChIKey | YYFGPUVOBXDRJK-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze tetramethyl cyclopentane-1,1,2,2-tetracarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetramethyl cyclopentane-1,1,2,2-tetracarboxylate?
The IUPAC name of tetramethyl cyclopentane-1,1,2,2-tetracarboxylate (CID 879029) is tetramethyl cyclopentane-1,1,2,2-tetracarboxylate.
What is the SMILES notation for tetramethyl cyclopentane-1,1,2,2-tetracarboxylate?
The canonical SMILES for tetramethyl cyclopentane-1,1,2,2-tetracarboxylate is COC(=O)C1(C(=O)OC)CCCC1(C(=O)OC)C(=O)OC.
What is the InChIKey of tetramethyl cyclopentane-1,1,2,2-tetracarboxylate?
The InChIKey is YYFGPUVOBXDRJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O8/c1-18-8(14)12(9(15)19-2)6-5-7-13(12,10(16)20-3)11(17)21-4/h5-7H2,1-4H3.
What are the key properties of tetramethyl cyclopentane-1,1,2,2-tetracarboxylate?
tetramethyl cyclopentane-1,1,2,2-tetracarboxylate has a molecular weight of 302.28 g/mol, XLogP of -0.16, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tetramethyl cyclopentane-1,1,2,2-tetracarboxylate is sourced from PubChem (CID 879029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).