C24H28F4O4S2 — CID 87903007
[1-(4-methoxynaphthalen-1-yl)thiolan-1-yl] 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 87903007) has the molecular formula C24H28F4O4S2 and a molecular weight of 520.61 g/mol. Its IUPAC name is [1-(4-methoxynaphthalen-1-yl)thiolan-1-yl] 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | [1-(4-methoxynaphthalen-1-yl)thiolan-1-yl] 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 87903007 |
| Molecular Formula | C24H28F4O4S2 |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | [1-(4-methoxynaphthalen-1-yl)thiolan-1-yl] 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | COc1ccc(S2(OS(=O)(=O)C(F)(F)C(F)(F)C3CC4CCC3C4)CCCC2)c2ccccc12 |
| InChI | InChI=1S/C24H28F4O4S2/c1-31-21-10-11-22(19-7-3-2-6-18(19)21)33(12-4-5-13-33)32-34(29,30)24(27,28)23(25,26)20-15-16-8-9-17(20)14-16/h2-3,6-7,10-11,16-17,20H,4-5,8-9,12-15H2,1H3 |
| InChIKey | SGDXEQBYRSXNAV-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|