C25H30F4O4S2 — CID 87903014
[1-(4-ethoxynaphthalen-1-yl)thiolan-1-yl] 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 87903014) has the molecular formula C25H30F4O4S2 and a molecular weight of 534.64 g/mol. Its IUPAC name is [1-(4-ethoxynaphthalen-1-yl)thiolan-1-yl] 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | [1-(4-ethoxynaphthalen-1-yl)thiolan-1-yl] 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 87903014 |
| Molecular Formula | C25H30F4O4S2 |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | [1-(4-ethoxynaphthalen-1-yl)thiolan-1-yl] 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | CCOc1ccc(S2(OS(=O)(=O)C(F)(F)C(F)(F)C3CC4CCC3C4)CCCC2)c2ccccc12 |
| InChI | InChI=1S/C25H30F4O4S2/c1-2-32-22-11-12-23(20-8-4-3-7-19(20)22)34(13-5-6-14-34)33-35(30,31)25(28,29)24(26,27)21-16-17-9-10-18(21)15-17/h3-4,7-8,11-12,17-18,21H,2,5-6,9-10,13-16H2,1H3 |
| InChIKey | XMHDFODDBJFTLG-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|