C40H32F6OSi2 — CID 87903597
[diphenyl-[2-(2,2,2-trifluoroethyl)phenyl]silyl]oxy-diphenyl-[2-(2,2,2-trifluoroethyl)phenyl]silane (PubChem CID 87903597) has the molecular formula C40H32F6OSi2 and a molecular weight of 698.86 g/mol. Its IUPAC name is [diphenyl-[2-(2,2,2-trifluoroethyl)phenyl]silyl]oxy-diphenyl-[2-(2,2,2-trifluoroethyl)phenyl]silane.
| Compound Name | [diphenyl-[2-(2,2,2-trifluoroethyl)phenyl]silyl]oxy-diphenyl-[2-(2,2,2-trifluoroethyl)phenyl]silane |
|---|---|
| PubChem CID | 87903597 |
| Molecular Formula | C40H32F6OSi2 |
| Molecular Weight | 698.86 g/mol |
| Exact Mass | 698.19 |
| IUPAC Name | [diphenyl-[2-(2,2,2-trifluoroethyl)phenyl]silyl]oxy-diphenyl-[2-(2,2,2-trifluoroethyl)phenyl]silane |
| SMILES | FC(F)(F)Cc1ccccc1[Si](O[Si](c1ccccc1)(c1ccccc1)c1ccccc1CC(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H32F6OSi2/c41-39(42,43)29-31-17-13-15-27-37(31)48(33-19-5-1-6-20-33,34-21-7-2-8-22-34)47-49(35-23-9-3-10-24-35,36-25-11-4-12-26-36)38-28-16-14-18-32(38)30-40(44,45)46/h1-28H,29-30H2 |
| InChIKey | RONYKPACEYLHHL-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.86 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|