C18H24O4 — CID 87903853
methyl 11-(1,3-dioxolan-2-yl)-2,6-dimethyldodeca-2,4,6,8,10-pentaenoate (PubChem CID 87903853) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is methyl 11-(1,3-dioxolan-2-yl)-2,6-dimethyldodeca-2,4,6,8,10-pentaenoate.
| Compound Name | methyl 11-(1,3-dioxolan-2-yl)-2,6-dimethyldodeca-2,4,6,8,10-pentaenoate |
|---|---|
| PubChem CID | 87903853 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | methyl 11-(1,3-dioxolan-2-yl)-2,6-dimethyldodeca-2,4,6,8,10-pentaenoate |
| SMILES | COC(=O)C(C)=CC=CC(C)=CC=CC=C(C)C1OCCO1 |
| InChI | InChI=1S/C18H24O4/c1-14(9-7-11-15(2)17(19)20-4)8-5-6-10-16(3)18-21-12-13-22-18/h5-11,18H,12-13H2,1-4H3 |
| InChIKey | XDTRKLGEZRQJBM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|