About bis(tripropylazanium);sulfate
bis(tripropylazanium);sulfate (PubChem CID 87903975) has the molecular formula C18H44N2O4S
and a molecular weight of 384.63 g/mol. Its IUPAC name is bis(tripropylazanium);sulfate.
Molecular Properties
| Compound Name | bis(tripropylazanium);sulfate |
| PubChem CID | 87903975 |
| Molecular Formula | C18H44N2O4S |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | bis(tripropylazanium);sulfate |
| SMILES | CCC[NH+](CCC)CCC.CCC[NH+](CCC)CCC.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C9H21N.H2O4S/c2*1-4-7-10(8-5-2)9-6-3;1-5(2,3)4/h2*4-9H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | JHDLAAOLTALPDG-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 89.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze bis(tripropylazanium);sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(tripropylazanium);sulfate?
The IUPAC name of bis(tripropylazanium);sulfate (CID 87903975) is bis(tripropylazanium);sulfate.
What is the SMILES notation for bis(tripropylazanium);sulfate?
The canonical SMILES for bis(tripropylazanium);sulfate is CCC[NH+](CCC)CCC.CCC[NH+](CCC)CCC.O=S(=O)([O-])[O-].
What is the InChIKey of bis(tripropylazanium);sulfate?
The InChIKey is JHDLAAOLTALPDG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H21N.H2O4S/c2*1-4-7-10(8-5-2)9-6-3;1-5(2,3)4/h2*4-9H2,1-3H3;(H2,1,2,3,4).
What are the key properties of bis(tripropylazanium);sulfate?
bis(tripropylazanium);sulfate has a molecular weight of 384.63 g/mol, XLogP of 0.86, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(tripropylazanium);sulfate is sourced from PubChem (CID 87903975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).