About tributyl(sulfo)azanium
tributyl(sulfo)azanium (PubChem CID 87904011) has the molecular formula C12H28NO3S+
and a molecular weight of 266.43 g/mol. Its IUPAC name is tributyl(sulfo)azanium.
Molecular Properties
| Compound Name | tributyl(sulfo)azanium |
| PubChem CID | 87904011 |
| Molecular Formula | C12H28NO3S+ |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | tributyl(sulfo)azanium |
| SMILES | CCCC[N+](CCCC)(CCCC)S(=O)(=O)O |
| InChI | InChI=1S/C12H27NO3S/c1-4-7-10-13(11-8-5-2,12-9-6-3)17(14,15)16/h4-12H2,1-3H3/p+1 |
| InChIKey | YZJZNKDOSHAIFQ-UHFFFAOYSA-O |
| XLogP | 3.01 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze tributyl(sulfo)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl(sulfo)azanium?
The IUPAC name of tributyl(sulfo)azanium (CID 87904011) is tributyl(sulfo)azanium.
What is the SMILES notation for tributyl(sulfo)azanium?
The canonical SMILES for tributyl(sulfo)azanium is CCCC[N+](CCCC)(CCCC)S(=O)(=O)O.
What is the InChIKey of tributyl(sulfo)azanium?
The InChIKey is YZJZNKDOSHAIFQ-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H27NO3S/c1-4-7-10-13(11-8-5-2,12-9-6-3)17(14,15)16/h4-12H2,1-3H3/p+1.
What are the key properties of tributyl(sulfo)azanium?
tributyl(sulfo)azanium has a molecular weight of 266.43 g/mol, XLogP of 3.01, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl(sulfo)azanium is sourced from PubChem (CID 87904011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).