C9H7ClN2O2S2 — CID 87904343
5-(4-chlorophenyl)sulfonyl-1,3-thiazol-2-amine (PubChem CID 87904343) has the molecular formula C9H7ClN2O2S2 and a molecular weight of 274.75 g/mol. Its IUPAC name is 5-(4-chlorophenyl)sulfonyl-1,3-thiazol-2-amine.
| Compound Name | 5-(4-chlorophenyl)sulfonyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 87904343 |
| Molecular Formula | C9H7ClN2O2S2 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 273.96 |
| IUPAC Name | 5-(4-chlorophenyl)sulfonyl-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(S(=O)(=O)c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C9H7ClN2O2S2/c10-6-1-3-7(4-2-6)16(13,14)8-5-12-9(11)15-8/h1-5H,(H2,11,12) |
| InChIKey | RLAFGXPUWSOWCR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |