C25H24F6 — CID 87905415
(1S,2S,4aR,10aS)-2-[(E)-but-1-enyl]-6,8-difluoro-1-[3-fluoro-4-(trifluoromethyl)phenyl]-1,2,3,4,4a,9,10,10a-octahydrophenanthrene (PubChem CID 87905415) has the molecular formula C25H24F6 and a molecular weight of 438.46 g/mol. Its IUPAC name is (1S,2S,4aR,10aS)-2-[(E)-but-1-enyl]-6,8-difluoro-1-[3-fluoro-4-(trifluoromethyl)phenyl]-1,2,3,4,4a,9,10,10a-octahydrophenanthrene.
| Compound Name | (1S,2S,4aR,10aS)-2-[(E)-but-1-enyl]-6,8-difluoro-1-[3-fluoro-4-(trifluoromethyl)phenyl]-1,2,3,4,4a,9,10,10a-octahydrophenanthrene |
|---|---|
| PubChem CID | 87905415 |
| Molecular Formula | C25H24F6 |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | (1S,2S,4aR,10aS)-2-[(E)-but-1-enyl]-6,8-difluoro-1-[3-fluoro-4-(trifluoromethyl)phenyl]-1,2,3,4,4a,9,10,10a-octahydrophenanthrene |
| SMILES | CC/C=C/[C@@H]1CC[C@H]2c3cc(F)cc(F)c3CC[C@@H]2[C@H]1c1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C25H24F6/c1-2-3-4-14-5-7-17-19(9-8-18-20(17)12-16(26)13-22(18)27)24(14)15-6-10-21(23(28)11-15)25(29,30)31/h3-4,6,10-14,17,19,24H,2,5,7-9H2,1H3/b4-3+/t14-,17-,19+,24-/m1/s1 |
| InChIKey | QVWCJTMUQKRQLJ-OQXMMKABSA-N |
| XLogP | 7.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|