C31H33N7S2 — CID 87905806
N'-[4-[[cyanomethyl(methyl)amino]methyl]phenyl]thiophene-2-carboximidamide;N'-[4-[[methyl(prop-2-ynyl)amino]methyl]phenyl]thiophene-2-carboximidamide (PubChem CID 87905806) has the molecular formula C31H33N7S2 and a molecular weight of 567.79 g/mol. Its IUPAC name is N'-[4-[[cyanomethyl(methyl)amino]methyl]phenyl]thiophene-2-carboximidamide;N'-[4-[[methyl(prop-2-ynyl)amino]methyl]phenyl]thiophene-2-carboximidamide.
| Compound Name | N'-[4-[[cyanomethyl(methyl)amino]methyl]phenyl]thiophene-2-carboximidamide;N'-[4-[[methyl(prop-2-ynyl)amino]methyl]phenyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 87905806 |
| Molecular Formula | C31H33N7S2 |
| Molecular Weight | 567.79 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | N'-[4-[[cyanomethyl(methyl)amino]methyl]phenyl]thiophene-2-carboximidamide;N'-[4-[[methyl(prop-2-ynyl)amino]methyl]phenyl]thiophene-2-carboximidamide |
| SMILES | C#CCN(C)Cc1ccc(/N=C(\N)c2cccs2)cc1.CN(CC#N)Cc1ccc(/N=C(\N)c2cccs2)cc1 |
| InChI | InChI=1S/C16H17N3S.C15H16N4S/c1-3-10-19(2)12-13-6-8-14(9-7-13)18-16(17)15-5-4-11-20-15;1-19(9-8-16)11-12-4-6-13(7-5-12)18-15(17)14-3-2-10-20-14/h1,4-9,11H,10,12H2,2H3,(H2,17,18);2-7,10H,9,11H2,1H3,(H2,17,18) |
| InChIKey | VBDULPFTGQKENO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.79 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|