C13H17NO2S — CID 879066
(2,4-dimethoxyphenyl)-pyrrolidin-1-ylmethanethione (PubChem CID 879066) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)-pyrrolidin-1-ylmethanethione.
| Compound Name | (2,4-dimethoxyphenyl)-pyrrolidin-1-ylmethanethione |
|---|---|
| PubChem CID | 879066 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | (2,4-dimethoxyphenyl)-pyrrolidin-1-ylmethanethione |
| SMILES | COc1ccc(C(=S)N2CCCC2)c(OC)c1 |
| InChI | InChI=1S/C13H17NO2S/c1-15-10-5-6-11(12(9-10)16-2)13(17)14-7-3-4-8-14/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | HZCKLMWNWWJTAJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|