C10H9NO4S — CID 87906742
4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)benzaldehyde (PubChem CID 87906742) has the molecular formula C10H9NO4S and a molecular weight of 239.25 g/mol. Its IUPAC name is 4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)benzaldehyde.
| Compound Name | 4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)benzaldehyde |
|---|---|
| PubChem CID | 87906742 |
| Molecular Formula | C10H9NO4S |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)benzaldehyde |
| SMILES | O=Cc1ccc(C2CC(=O)NS2(=O)=O)cc1 |
| InChI | InChI=1S/C10H9NO4S/c12-6-7-1-3-8(4-2-7)9-5-10(13)11-16(9,14)15/h1-4,6,9H,5H2,(H,11,13) |
| InChIKey | HQJHKMIPZMGCIX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|