C28H22F6N4O7S2 — CID 87906818
methyl 2-[(1S)-1-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]-2-[4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-3H-benzimidazole-5-carboxylate (PubChem CID 87906818) has the molecular formula C28H22F6N4O7S2 and a molecular weight of 704.63 g/mol. Its IUPAC name is methyl 2-[(1S)-1-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]-2-[4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-3H-benzimidazole-5-carboxylate.
| Compound Name | methyl 2-[(1S)-1-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]-2-[4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 87906818 |
| Molecular Formula | C28H22F6N4O7S2 |
| Molecular Weight | 704.63 g/mol |
| Exact Mass | 704.08 |
| IUPAC Name | methyl 2-[(1S)-1-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]-2-[4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-3H-benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2nc([C@H](Cc3ccc(C4CC(=O)NS4(=O)=O)cc3)NS(=O)(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)[nH]c2c1 |
| InChI | InChI=1S/C28H22F6N4O7S2/c1-45-26(40)16-6-7-20-21(9-16)36-25(35-20)22(8-14-2-4-15(5-3-14)23-13-24(39)38-47(23,43)44)37-46(41,42)19-11-17(27(29,30)31)10-18(12-19)28(32,33)34/h2-7,9-12,22-23,37H,8,13H2,1H3,(H,35,36)(H,38,39)/t22-,23?/m0/s1 |
| InChIKey | RJHXNAREFJMBQE-NQCNTLBGSA-N |
| XLogP | 4.54 |
| TPSA | 164.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.63 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |