C27H22F6N4O5S2 — CID 87906835
N-[(1S)-1-(6-methyl-1H-benzimidazol-2-yl)-2-[4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-3,5-bis(trifluoromethyl)benzenesulfonamide (PubChem CID 87906835) has the molecular formula C27H22F6N4O5S2 and a molecular weight of 660.62 g/mol. Its IUPAC name is N-[(1S)-1-(6-methyl-1H-benzimidazol-2-yl)-2-[4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-3,5-bis(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[(1S)-1-(6-methyl-1H-benzimidazol-2-yl)-2-[4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-3,5-bis(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 87906835 |
| Molecular Formula | C27H22F6N4O5S2 |
| Molecular Weight | 660.62 g/mol |
| Exact Mass | 660.09 |
| IUPAC Name | N-[(1S)-1-(6-methyl-1H-benzimidazol-2-yl)-2-[4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-3,5-bis(trifluoromethyl)benzenesulfonamide |
| SMILES | Cc1ccc2nc([C@H](Cc3ccc(C4CC(=O)NS4(=O)=O)cc3)NS(=O)(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)[nH]c2c1 |
| InChI | InChI=1S/C27H22F6N4O5S2/c1-14-2-7-20-21(8-14)35-25(34-20)22(9-15-3-5-16(6-4-15)23-13-24(38)37-44(23,41)42)36-43(39,40)19-11-17(26(28,29)30)10-18(12-19)27(31,32)33/h2-8,10-12,22-23,36H,9,13H2,1H3,(H,34,35)(H,37,38)/t22-,23?/m0/s1 |
| InChIKey | VZOITMWPQPBDEY-NQCNTLBGSA-N |
| XLogP | 5.06 |
| TPSA | 138.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |