C23H21BrO3 — CID 87906872
2-bromo-1-[2-methyl-3,4-bis(phenylmethoxy)phenyl]ethanone (PubChem CID 87906872) has the molecular formula C23H21BrO3 and a molecular weight of 425.32 g/mol. Its IUPAC name is 2-bromo-1-[2-methyl-3,4-bis(phenylmethoxy)phenyl]ethanone.
| Compound Name | 2-bromo-1-[2-methyl-3,4-bis(phenylmethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 87906872 |
| Molecular Formula | C23H21BrO3 |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 2-bromo-1-[2-methyl-3,4-bis(phenylmethoxy)phenyl]ethanone |
| SMILES | Cc1c(C(=O)CBr)ccc(OCc2ccccc2)c1OCc1ccccc1 |
| InChI | InChI=1S/C23H21BrO3/c1-17-20(21(25)14-24)12-13-22(26-15-18-8-4-2-5-9-18)23(17)27-16-19-10-6-3-7-11-19/h2-13H,14-16H2,1H3 |
| InChIKey | LCVPPKRNBBUIJF-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|