About dibenzyltin;dihydrobromide
dibenzyltin;dihydrobromide (PubChem CID 87907126) has the molecular formula C14H16Br2Sn
and a molecular weight of 462.80 g/mol. Its IUPAC name is dibenzyltin;dihydrobromide.
Molecular Properties
| Compound Name | dibenzyltin;dihydrobromide |
| PubChem CID | 87907126 |
| Molecular Formula | C14H16Br2Sn |
| Molecular Weight | 462.80 g/mol |
| Exact Mass | 461.86 |
| IUPAC Name | dibenzyltin;dihydrobromide |
| SMILES | Br.Br.c1ccc(C[Sn]Cc2ccccc2)cc1 |
| InChI | InChI=1S/2C7H7.2BrH.Sn/c2*1-7-5-3-2-4-6-7;;;/h2*2-6H,1H2;2*1H; |
| InChIKey | GUEVPXYYCMJSHC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.80 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze dibenzyltin;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzyltin;dihydrobromide?
The IUPAC name of dibenzyltin;dihydrobromide (CID 87907126) is dibenzyltin;dihydrobromide.
What is the SMILES notation for dibenzyltin;dihydrobromide?
The canonical SMILES for dibenzyltin;dihydrobromide is Br.Br.c1ccc(C[Sn]Cc2ccccc2)cc1.
What is the InChIKey of dibenzyltin;dihydrobromide?
The InChIKey is GUEVPXYYCMJSHC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H7.2BrH.Sn/c2*1-7-5-3-2-4-6-7;;;/h2*2-6H,1H2;2*1H;.
What are the key properties of dibenzyltin;dihydrobromide?
dibenzyltin;dihydrobromide has a molecular weight of 462.80 g/mol, XLogP of 4.25, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzyltin;dihydrobromide is sourced from PubChem (CID 87907126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).