C25H22F5N3O4 — CID 87907465
trans-(1R,2R)-4,4-difluoro-N-hydroxy-2-[4-[(2-methylquinolin-4-yl)methoxy]-N-(2,2,2-trifluoroacetyl)anilino]cyclopentane-1-carboxamide (PubChem CID 87907465) has the molecular formula C25H22F5N3O4 and a molecular weight of 523.46 g/mol. Its IUPAC name is trans-(1R,2R)-4,4-difluoro-N-hydroxy-2-[4-[(2-methylquinolin-4-yl)methoxy]-N-(2,2,2-trifluoroacetyl)anilino]cyclopentane-1-carboxamide.
| Compound Name | trans-(1R,2R)-4,4-difluoro-N-hydroxy-2-[4-[(2-methylquinolin-4-yl)methoxy]-N-(2,2,2-trifluoroacetyl)anilino]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 87907465 |
| Molecular Formula | C25H22F5N3O4 |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | trans-(1R,2R)-4,4-difluoro-N-hydroxy-2-[4-[(2-methylquinolin-4-yl)methoxy]-N-(2,2,2-trifluoroacetyl)anilino]cyclopentane-1-carboxamide |
| SMILES | Cc1cc(COc2ccc(N(C(=O)C(F)(F)F)[C@@H]3CC(F)(F)C[C@H]3C(=O)NO)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C25H22F5N3O4/c1-14-10-15(18-4-2-3-5-20(18)31-14)13-37-17-8-6-16(7-9-17)33(23(35)25(28,29)30)21-12-24(26,27)11-19(21)22(34)32-36/h2-10,19,21,36H,11-13H2,1H3,(H,32,34)/t19-,21-/m1/s1 |
| InChIKey | RBALEUGBHWAUFJ-TZIWHRDSSA-N |
| XLogP | 4.94 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|