C23H23F5N2O5 — CID 87907846
ethyl 6,7-dimethoxy-2-methyl-4-[[(2,3,4,5,6-pentafluorobenzoyl)amino]methyl]-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 87907846) has the molecular formula C23H23F5N2O5 and a molecular weight of 502.44 g/mol. Its IUPAC name is ethyl 6,7-dimethoxy-2-methyl-4-[[(2,3,4,5,6-pentafluorobenzoyl)amino]methyl]-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | ethyl 6,7-dimethoxy-2-methyl-4-[[(2,3,4,5,6-pentafluorobenzoyl)amino]methyl]-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 87907846 |
| Molecular Formula | C23H23F5N2O5 |
| Molecular Weight | 502.44 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | ethyl 6,7-dimethoxy-2-methyl-4-[[(2,3,4,5,6-pentafluorobenzoyl)amino]methyl]-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CCOC(=O)N1c2cc(OC)c(OC)cc2C(CNC(=O)c2c(F)c(F)c(F)c(F)c2F)CC1C |
| InChI | InChI=1S/C23H23F5N2O5/c1-5-35-23(32)30-10(2)6-11(12-7-14(33-3)15(34-4)8-13(12)30)9-29-22(31)16-17(24)19(26)21(28)20(27)18(16)25/h7-8,10-11H,5-6,9H2,1-4H3,(H,29,31) |
| InChIKey | UKDLPNQYLVUXPY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|