C24H47N2O2- — CID 87908193
3,7-di(nonyl)-1-oxido-1,3-diazocan-5-one (PubChem CID 87908193) has the molecular formula C24H47N2O2- and a molecular weight of 395.65 g/mol. Its IUPAC name is 3,7-di(nonyl)-1-oxido-1,3-diazocan-5-one.
| Compound Name | 3,7-di(nonyl)-1-oxido-1,3-diazocan-5-one |
|---|---|
| PubChem CID | 87908193 |
| Molecular Formula | C24H47N2O2- |
| Molecular Weight | 395.65 g/mol |
| Exact Mass | 395.36 |
| IUPAC Name | 3,7-di(nonyl)-1-oxido-1,3-diazocan-5-one |
| SMILES | CCCCCCCCCC1CC(=O)CN(CCCCCCCCC)CN([O-])C1 |
| InChI | InChI=1S/C24H47N2O2/c1-3-5-7-9-11-13-15-17-23-19-24(27)21-25(22-26(28)20-23)18-16-14-12-10-8-6-4-2/h23H,3-22H2,1-2H3/q-1 |
| InChIKey | FVVSDNVZGGIBLL-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.65 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|