C20H23ClN4O6S2 — CID 87908296
N'-[5-chloro-4-(methanesulfonamidomethyl)-1,3-thiazol-2-yl]-N-[2-(cyclopentanecarbonyl)-4-methoxyphenyl]oxamide (PubChem CID 87908296) has the molecular formula C20H23ClN4O6S2 and a molecular weight of 515.01 g/mol. Its IUPAC name is N'-[5-chloro-4-(methanesulfonamidomethyl)-1,3-thiazol-2-yl]-N-[2-(cyclopentanecarbonyl)-4-methoxyphenyl]oxamide.
| Compound Name | N'-[5-chloro-4-(methanesulfonamidomethyl)-1,3-thiazol-2-yl]-N-[2-(cyclopentanecarbonyl)-4-methoxyphenyl]oxamide |
|---|---|
| PubChem CID | 87908296 |
| Molecular Formula | C20H23ClN4O6S2 |
| Molecular Weight | 515.01 g/mol |
| Exact Mass | 514.07 |
| IUPAC Name | N'-[5-chloro-4-(methanesulfonamidomethyl)-1,3-thiazol-2-yl]-N-[2-(cyclopentanecarbonyl)-4-methoxyphenyl]oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)Nc2nc(CNS(C)(=O)=O)c(Cl)s2)c(C(=O)C2CCCC2)c1 |
| InChI | InChI=1S/C20H23ClN4O6S2/c1-31-12-7-8-14(13(9-12)16(26)11-5-3-4-6-11)23-18(27)19(28)25-20-24-15(17(21)32-20)10-22-33(2,29)30/h7-9,11,22H,3-6,10H2,1-2H3,(H,23,27)(H,24,25,28) |
| InChIKey | QGGFJDNLBIDJJE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 143.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.01 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|