C21H21O12+ — CID 87908614
(2R,3S,4R,5R)-3-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromenylium-3-yl]peroxy-2,4,5,6-tetrahydroxyhexanal (PubChem CID 87908614) has the molecular formula C21H21O12+ and a molecular weight of 465.39 g/mol. Its IUPAC name is (2R,3S,4R,5R)-3-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromenylium-3-yl]peroxy-2,4,5,6-tetrahydroxyhexanal.
| Compound Name | (2R,3S,4R,5R)-3-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromenylium-3-yl]peroxy-2,4,5,6-tetrahydroxyhexanal |
|---|---|
| PubChem CID | 87908614 |
| Molecular Formula | C21H21O12+ |
| Molecular Weight | 465.39 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | (2R,3S,4R,5R)-3-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromenylium-3-yl]peroxy-2,4,5,6-tetrahydroxyhexanal |
| SMILES | O=C[C@H](O)[C@@H](OOc1cc2c(O)cc(O)cc2[o+]c1-c1ccc(O)c(O)c1)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C21H20O12/c22-7-15(28)19(30)21(16(29)8-23)33-32-18-6-11-13(26)4-10(24)5-17(11)31-20(18)9-1-2-12(25)14(27)3-9/h1-6,8,15-16,19,21-22,28-30H,7H2,(H3-,24,25,26,27)/p+1/t15-,16+,19-,21-/m1/s1 |
| InChIKey | BFNNRNOJULFDLW-NNNWTRQLSA-O |
| XLogP | 0.16 |
| TPSA | 208.67 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.39 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|