C21H22F6O4 — CID 87908642
1-[4-[1,1,1,3,3,3-hexafluoro-2-[(4-methoxyphenyl)methoxy]propan-2-yl]-2,6-dimethylphenoxy]ethanol (PubChem CID 87908642) has the molecular formula C21H22F6O4 and a molecular weight of 452.39 g/mol. Its IUPAC name is 1-[4-[1,1,1,3,3,3-hexafluoro-2-[(4-methoxyphenyl)methoxy]propan-2-yl]-2,6-dimethylphenoxy]ethanol.
| Compound Name | 1-[4-[1,1,1,3,3,3-hexafluoro-2-[(4-methoxyphenyl)methoxy]propan-2-yl]-2,6-dimethylphenoxy]ethanol |
|---|---|
| PubChem CID | 87908642 |
| Molecular Formula | C21H22F6O4 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 1-[4-[1,1,1,3,3,3-hexafluoro-2-[(4-methoxyphenyl)methoxy]propan-2-yl]-2,6-dimethylphenoxy]ethanol |
| SMILES | COc1ccc(COC(c2cc(C)c(OC(C)O)c(C)c2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H22F6O4/c1-12-9-16(10-13(2)18(12)31-14(3)28)19(20(22,23)24,21(25,26)27)30-11-15-5-7-17(29-4)8-6-15/h5-10,14,28H,11H2,1-4H3 |
| InChIKey | NJWBXDLTHYGWHL-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|