About 3-ethyl-3-(2-hydroxypropan-2-yl)-2,4-dimethylpentane-2,4-diol
3-ethyl-3-(2-hydroxypropan-2-yl)-2,4-dimethylpentane-2,4-diol (PubChem CID 87908652) has the molecular formula C12H26O3
and a molecular weight of 218.34 g/mol. Its IUPAC name is 3-ethyl-3-(2-hydroxypropan-2-yl)-2,4-dimethylpentane-2,4-diol.
Molecular Properties
| Compound Name | 3-ethyl-3-(2-hydroxypropan-2-yl)-2,4-dimethylpentane-2,4-diol |
| PubChem CID | 87908652 |
| Molecular Formula | C12H26O3 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.19 |
| IUPAC Name | 3-ethyl-3-(2-hydroxypropan-2-yl)-2,4-dimethylpentane-2,4-diol |
| SMILES | CCC(C(C)(C)O)(C(C)(C)O)C(C)(C)O |
| InChI | InChI=1S/C12H26O3/c1-8-12(9(2,3)13,10(4,5)14)11(6,7)15/h13-15H,8H2,1-7H3 |
| InChIKey | VCPCJLKERJZBDD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-3-(2-hydroxypropan-2-yl)-2,4-dimethylpentane-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-3-(2-hydroxypropan-2-yl)-2,4-dimethylpentane-2,4-diol?
The IUPAC name of 3-ethyl-3-(2-hydroxypropan-2-yl)-2,4-dimethylpentane-2,4-diol (CID 87908652) is 3-ethyl-3-(2-hydroxypropan-2-yl)-2,4-dimethylpentane-2,4-diol.
What is the SMILES notation for 3-ethyl-3-(2-hydroxypropan-2-yl)-2,4-dimethylpentane-2,4-diol?
The canonical SMILES for 3-ethyl-3-(2-hydroxypropan-2-yl)-2,4-dimethylpentane-2,4-diol is CCC(C(C)(C)O)(C(C)(C)O)C(C)(C)O.
What is the InChIKey of 3-ethyl-3-(2-hydroxypropan-2-yl)-2,4-dimethylpentane-2,4-diol?
The InChIKey is VCPCJLKERJZBDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O3/c1-8-12(9(2,3)13,10(4,5)14)11(6,7)15/h13-15H,8H2,1-7H3.
What are the key properties of 3-ethyl-3-(2-hydroxypropan-2-yl)-2,4-dimethylpentane-2,4-diol?
3-ethyl-3-(2-hydroxypropan-2-yl)-2,4-dimethylpentane-2,4-diol has a molecular weight of 218.34 g/mol, XLogP of 1.70, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-3-(2-hydroxypropan-2-yl)-2,4-dimethylpentane-2,4-diol is sourced from PubChem (CID 87908652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).