C12H31N3O3Si — CID 87909246
1-N,1-N',1-N"-triethyl-3-trimethoxysilylpropane-1,1,1-triamine (PubChem CID 87909246) has the molecular formula C12H31N3O3Si and a molecular weight of 293.48 g/mol. Its IUPAC name is 1-N,1-N',1-N"-triethyl-3-trimethoxysilylpropane-1,1,1-triamine.
| Compound Name | 1-N,1-N',1-N"-triethyl-3-trimethoxysilylpropane-1,1,1-triamine |
|---|---|
| PubChem CID | 87909246 |
| Molecular Formula | C12H31N3O3Si |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 1-N,1-N',1-N"-triethyl-3-trimethoxysilylpropane-1,1,1-triamine |
| SMILES | CCNC(CC[Si](OC)(OC)OC)(NCC)NCC |
| InChI | InChI=1S/C12H31N3O3Si/c1-7-13-12(14-8-2,15-9-3)10-11-19(16-4,17-5)18-6/h13-15H,7-11H2,1-6H3 |
| InChIKey | ZHQRFQCZNCYUSX-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 63.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|