C19H32O11Si — CID 87909503
(Z,3S,7S)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-dihydroxynon-4-ene-1,1,9,9-tetracarboxylic acid (PubChem CID 87909503) has the molecular formula C19H32O11Si and a molecular weight of 464.54 g/mol. Its IUPAC name is (Z,3S,7S)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-dihydroxynon-4-ene-1,1,9,9-tetracarboxylic acid.
| Compound Name | (Z,3S,7S)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-dihydroxynon-4-ene-1,1,9,9-tetracarboxylic acid |
|---|---|
| PubChem CID | 87909503 |
| Molecular Formula | C19H32O11Si |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | (Z,3S,7S)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-dihydroxynon-4-ene-1,1,9,9-tetracarboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)O/C(=C\[C@@H](O)CC(C(=O)O)C(=O)O)C[C@@H](O)CC(C(=O)O)C(=O)O |
| InChI | InChI=1S/C19H32O11Si/c1-19(2,3)31(4,5)30-12(6-10(20)8-13(15(22)23)16(24)25)7-11(21)9-14(17(26)27)18(28)29/h6,10-11,13-14,20-21H,7-9H2,1-5H3,(H,22,23)(H,24,25)(H,26,27)(H,28,29)/b12-6-/t10-,11-/m1/s1 |
| InChIKey | SFSQBBRJBBZKFJ-OYHMZJHOSA-N |
| XLogP | 1.36 |
| TPSA | 198.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|