About N,N-dimethylformamide;methyl formate
N,N-dimethylformamide;methyl formate (PubChem CID 87909545) has the molecular formula C5H11NO3
and a molecular weight of 133.15 g/mol. Its IUPAC name is N,N-dimethylformamide;methyl formate.
Molecular Properties
| Compound Name | N,N-dimethylformamide;methyl formate |
| PubChem CID | 87909545 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | N,N-dimethylformamide;methyl formate |
| SMILES | CN(C)C=O.COC=O |
| InChI | InChI=1S/C3H7NO.C2H4O2/c1-4(2)3-5;1-4-2-3/h3H,1-2H3;2H,1H3 |
| InChIKey | TVPFSGHMIMPUJD-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylformamide;methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylformamide;methyl formate?
The IUPAC name of N,N-dimethylformamide;methyl formate (CID 87909545) is N,N-dimethylformamide;methyl formate.
What is the SMILES notation for N,N-dimethylformamide;methyl formate?
The canonical SMILES for N,N-dimethylformamide;methyl formate is CN(C)C=O.COC=O.
What is the InChIKey of N,N-dimethylformamide;methyl formate?
The InChIKey is TVPFSGHMIMPUJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.C2H4O2/c1-4(2)3-5;1-4-2-3/h3H,1-2H3;2H,1H3.
What are the key properties of N,N-dimethylformamide;methyl formate?
N,N-dimethylformamide;methyl formate has a molecular weight of 133.15 g/mol, XLogP of -0.51, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylformamide;methyl formate is sourced from PubChem (CID 87909545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).