C27H38O6P2 — CID 87909815
3,9-bis[(2-butan-2-ylphenyl)methoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane (PubChem CID 87909815) has the molecular formula C27H38O6P2 and a molecular weight of 520.54 g/mol. Its IUPAC name is 3,9-bis[(2-butan-2-ylphenyl)methoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane.
| Compound Name | 3,9-bis[(2-butan-2-ylphenyl)methoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
|---|---|
| PubChem CID | 87909815 |
| Molecular Formula | C27H38O6P2 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | 3,9-bis[(2-butan-2-ylphenyl)methoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
| SMILES | CCC(C)c1ccccc1COP1OCC2(CO1)COP(OCc1ccccc1C(C)CC)OC2 |
| InChI | InChI=1S/C27H38O6P2/c1-5-21(3)25-13-9-7-11-23(25)15-28-34-30-17-27(18-31-34)19-32-35(33-20-27)29-16-24-12-8-10-14-26(24)22(4)6-2/h7-14,21-22H,5-6,15-20H2,1-4H3 |
| InChIKey | SFVUIAYLEDZITA-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|