C37H36N2 — CID 87909884
2,4,4-trimethyl-3-[7-(2,4,4-trimethyl-2H-carbazol-3-ylidene)hepta-1,3,5-trienyl]carbazole (PubChem CID 87909884) has the molecular formula C37H36N2 and a molecular weight of 508.71 g/mol. Its IUPAC name is 2,4,4-trimethyl-3-[7-(2,4,4-trimethyl-2H-carbazol-3-ylidene)hepta-1,3,5-trienyl]carbazole.
| Compound Name | 2,4,4-trimethyl-3-[7-(2,4,4-trimethyl-2H-carbazol-3-ylidene)hepta-1,3,5-trienyl]carbazole |
|---|---|
| PubChem CID | 87909884 |
| Molecular Formula | C37H36N2 |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | 2,4,4-trimethyl-3-[7-(2,4,4-trimethyl-2H-carbazol-3-ylidene)hepta-1,3,5-trienyl]carbazole |
| SMILES | CC1=C(C=CC=CC=CC=C2C(C)C=C3N=c4ccccc4=C3C2(C)C)C(C)(C)C2=c3ccccc3=NC2=C1 |
| InChI | InChI=1S/C37H36N2/c1-24-22-32-34(26-16-12-14-20-30(26)38-32)36(3,4)28(24)18-10-8-7-9-11-19-29-25(2)23-33-35(37(29,5)6)27-17-13-15-21-31(27)39-33/h7-24H,1-6H3 |
| InChIKey | AYGSSCUFIBOFMU-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|