About ethane;(2-methyl-6-propan-2-ylphenyl)iminonickel;pyrimidine
ethane;(2-methyl-6-propan-2-ylphenyl)iminonickel;pyrimidine (PubChem CID 87910252) has the molecular formula C16H22N3Ni-
and a molecular weight of 315.07 g/mol. Its IUPAC name is ethane;(2-methyl-6-propan-2-ylphenyl)iminonickel;pyrimidine.
Molecular Properties
| Compound Name | ethane;(2-methyl-6-propan-2-ylphenyl)iminonickel;pyrimidine |
| PubChem CID | 87910252 |
| Molecular Formula | C16H22N3Ni- |
| Molecular Weight | 315.07 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | ethane;(2-methyl-6-propan-2-ylphenyl)iminonickel;pyrimidine |
| SMILES | Cc1cccc(C(C)C)c1N=[Ni].[CH2-]C.c1cncnc1 |
| InChI | InChI=1S/C10H13N.C4H4N2.C2H5.Ni/c1-7(2)9-6-4-5-8(3)10(9)11;1-2-5-4-6-3-1;1-2;/h4-7H,1-3H3;1-4H;1H2,2H3;/q;;-1; |
| InChIKey | XHNCUVMGIGYSED-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.07 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2-methyl-6-propan-2-ylphenyl)iminonickel;pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2-methyl-6-propan-2-ylphenyl)iminonickel;pyrimidine?
The IUPAC name of ethane;(2-methyl-6-propan-2-ylphenyl)iminonickel;pyrimidine (CID 87910252) is ethane;(2-methyl-6-propan-2-ylphenyl)iminonickel;pyrimidine.
What is the SMILES notation for ethane;(2-methyl-6-propan-2-ylphenyl)iminonickel;pyrimidine?
The canonical SMILES for ethane;(2-methyl-6-propan-2-ylphenyl)iminonickel;pyrimidine is Cc1cccc(C(C)C)c1N=[Ni].[CH2-]C.c1cncnc1.
What is the InChIKey of ethane;(2-methyl-6-propan-2-ylphenyl)iminonickel;pyrimidine?
The InChIKey is XHNCUVMGIGYSED-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N.C4H4N2.C2H5.Ni/c1-7(2)9-6-4-5-8(3)10(9)11;1-2-5-4-6-3-1;1-2;/h4-7H,1-3H3;1-4H;1H2,2H3;/q;;-1;.
What are the key properties of ethane;(2-methyl-6-propan-2-ylphenyl)iminonickel;pyrimidine?
ethane;(2-methyl-6-propan-2-ylphenyl)iminonickel;pyrimidine has a molecular weight of 315.07 g/mol, XLogP of 4.80, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2-methyl-6-propan-2-ylphenyl)iminonickel;pyrimidine is sourced from PubChem (CID 87910252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).