C48H76N2Ni — CID 87910797
5-N,6-N-bis(2-tridec-4-enylphenyl)decane-5,6-diimine;nickel (PubChem CID 87910797) has the molecular formula C48H76N2Ni and a molecular weight of 739.84 g/mol. Its IUPAC name is 5-N,6-N-bis(2-tridec-4-enylphenyl)decane-5,6-diimine;nickel.
| Compound Name | 5-N,6-N-bis(2-tridec-4-enylphenyl)decane-5,6-diimine;nickel |
|---|---|
| PubChem CID | 87910797 |
| Molecular Formula | C48H76N2Ni |
| Molecular Weight | 739.84 g/mol |
| Exact Mass | 738.54 |
| IUPAC Name | 5-N,6-N-bis(2-tridec-4-enylphenyl)decane-5,6-diimine;nickel |
| SMILES | CCCCCCCCC=CCCCc1ccccc1/N=C(CCCC)/C(CCCC)=N/c1ccccc1CCCC=CCCCCCCCC.[Ni] |
| InChI | InChI=1S/C48H76N2.Ni/c1-5-9-13-15-17-19-21-23-25-27-29-35-43-37-31-33-41-45(43)49-47(39-11-7-3)48(40-12-8-4)50-46-42-34-32-38-44(46)36-30-28-26-24-22-20-18-16-14-10-6-2;/h23-26,31-34,37-38,41-42H,5-22,27-30,35-36,39-40H2,1-4H3;/b25-23?,26-24?,49-47+,50-48+; |
| InChIKey | RUMAVIXQCJRJSZ-IRYLGRJFSA-N |
| XLogP | 16.17 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.84 |
| LogP ≤ 5 | 16.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|