C26H46O9 — CID 87912270
decyl 2,3-dihydroxypropanoate;1,1-diethoxyethane;2,3-dihydroxybenzaldehyde (PubChem CID 87912270) has the molecular formula C26H46O9 and a molecular weight of 502.65 g/mol. Its IUPAC name is decyl 2,3-dihydroxypropanoate;1,1-diethoxyethane;2,3-dihydroxybenzaldehyde.
| Compound Name | decyl 2,3-dihydroxypropanoate;1,1-diethoxyethane;2,3-dihydroxybenzaldehyde |
|---|---|
| PubChem CID | 87912270 |
| Molecular Formula | C26H46O9 |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | decyl 2,3-dihydroxypropanoate;1,1-diethoxyethane;2,3-dihydroxybenzaldehyde |
| SMILES | CCCCCCCCCCOC(=O)C(O)CO.CCOC(C)OCC.O=Cc1cccc(O)c1O |
| InChI | InChI=1S/C13H26O4.C7H6O3.C6H14O2/c1-2-3-4-5-6-7-8-9-10-17-13(16)12(15)11-14;8-4-5-2-1-3-6(9)7(5)10;1-4-7-6(3)8-5-2/h12,14-15H,2-11H2,1H3;1-4,9-10H;6H,4-5H2,1-3H3 |
| InChIKey | RILZDCRAKUNCTG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|