C18H15Cl6N3O4S2 — CID 87912634
2-N-(trichloromethylsulfanyl)cyclohex-4-ene-1,2-dicarboxamide;2-(trichloromethylsulfanyl)isoindole-1,3-dione (PubChem CID 87912634) has the molecular formula C18H15Cl6N3O4S2 and a molecular weight of 614.19 g/mol. Its IUPAC name is 2-N-(trichloromethylsulfanyl)cyclohex-4-ene-1,2-dicarboxamide;2-(trichloromethylsulfanyl)isoindole-1,3-dione.
| Compound Name | 2-N-(trichloromethylsulfanyl)cyclohex-4-ene-1,2-dicarboxamide;2-(trichloromethylsulfanyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 87912634 |
| Molecular Formula | C18H15Cl6N3O4S2 |
| Molecular Weight | 614.19 g/mol |
| Exact Mass | 610.86 |
| IUPAC Name | 2-N-(trichloromethylsulfanyl)cyclohex-4-ene-1,2-dicarboxamide;2-(trichloromethylsulfanyl)isoindole-1,3-dione |
| SMILES | NC(=O)C1CC=CCC1C(=O)NSC(Cl)(Cl)Cl.O=C1c2ccccc2C(=O)N1SC(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H11Cl3N2O2S.C9H4Cl3NO2S/c10-9(11,12)17-14-8(16)6-4-2-1-3-5(6)7(13)15;10-9(11,12)16-13-7(14)5-3-1-2-4-6(5)8(13)15/h1-2,5-6H,3-4H2,(H2,13,15)(H,14,16);1-4H |
| InChIKey | OFHIWUNRNXVSBA-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.19 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|