About N-methylprop-2-enamide;propane-1-sulfonic acid
N-methylprop-2-enamide;propane-1-sulfonic acid (PubChem CID 87912780) has the molecular formula C7H15NO4S
and a molecular weight of 209.27 g/mol. Its IUPAC name is N-methylprop-2-enamide;propane-1-sulfonic acid.
Molecular Properties
| Compound Name | N-methylprop-2-enamide;propane-1-sulfonic acid |
| PubChem CID | 87912780 |
| Molecular Formula | C7H15NO4S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | N-methylprop-2-enamide;propane-1-sulfonic acid |
| SMILES | C=CC(=O)NC.CCCS(=O)(=O)O |
| InChI | InChI=1S/C4H7NO.C3H8O3S/c1-3-4(6)5-2;1-2-3-7(4,5)6/h3H,1H2,2H3,(H,5,6);2-3H2,1H3,(H,4,5,6) |
| InChIKey | LFJIAQOELDZMAR-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze N-methylprop-2-enamide;propane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylprop-2-enamide;propane-1-sulfonic acid?
The IUPAC name of N-methylprop-2-enamide;propane-1-sulfonic acid (CID 87912780) is N-methylprop-2-enamide;propane-1-sulfonic acid.
What is the SMILES notation for N-methylprop-2-enamide;propane-1-sulfonic acid?
The canonical SMILES for N-methylprop-2-enamide;propane-1-sulfonic acid is C=CC(=O)NC.CCCS(=O)(=O)O.
What is the InChIKey of N-methylprop-2-enamide;propane-1-sulfonic acid?
The InChIKey is LFJIAQOELDZMAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO.C3H8O3S/c1-3-4(6)5-2;1-2-3-7(4,5)6/h3H,1H2,2H3,(H,5,6);2-3H2,1H3,(H,4,5,6).
What are the key properties of N-methylprop-2-enamide;propane-1-sulfonic acid?
N-methylprop-2-enamide;propane-1-sulfonic acid has a molecular weight of 209.27 g/mol, XLogP of 0.20, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylprop-2-enamide;propane-1-sulfonic acid is sourced from PubChem (CID 87912780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).