C15H13ClF3N5O3 — CID 87912830
[(3R,4S)-1-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-4-(2,4,5-trifluorophenyl)pyrrolidin-3-yl]carbamic acid (PubChem CID 87912830) has the molecular formula C15H13ClF3N5O3 and a molecular weight of 403.75 g/mol. Its IUPAC name is [(3R,4S)-1-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-4-(2,4,5-trifluorophenyl)pyrrolidin-3-yl]carbamic acid.
| Compound Name | [(3R,4S)-1-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-4-(2,4,5-trifluorophenyl)pyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 87912830 |
| Molecular Formula | C15H13ClF3N5O3 |
| Molecular Weight | 403.75 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | [(3R,4S)-1-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-4-(2,4,5-trifluorophenyl)pyrrolidin-3-yl]carbamic acid |
| SMILES | COc1nc(Cl)nc(N2C[C@H](NC(=O)O)[C@@H](c3cc(F)c(F)cc3F)C2)n1 |
| InChI | InChI=1S/C15H13ClF3N5O3/c1-27-14-22-12(16)21-13(23-14)24-4-7(11(5-24)20-15(25)26)6-2-9(18)10(19)3-8(6)17/h2-3,7,11,20H,4-5H2,1H3,(H,25,26)/t7-,11+/m1/s1 |
| InChIKey | GYFNSLNLUOJOLI-HQJQHLMTSA-N |
| XLogP | 2.19 |
| TPSA | 100.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.75 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|