C25H17Cl2F2N3O4 — CID 87912942
3,5-dichloro-4-[4-[[(2S)-1-[cyano(methyl)amino]-2-(2,6-difluorophenyl)-1-oxopropan-2-yl]carbamoyl]phenyl]benzoic acid (PubChem CID 87912942) has the molecular formula C25H17Cl2F2N3O4 and a molecular weight of 532.33 g/mol. Its IUPAC name is 3,5-dichloro-4-[4-[[(2S)-1-[cyano(methyl)amino]-2-(2,6-difluorophenyl)-1-oxopropan-2-yl]carbamoyl]phenyl]benzoic acid.
| Compound Name | 3,5-dichloro-4-[4-[[(2S)-1-[cyano(methyl)amino]-2-(2,6-difluorophenyl)-1-oxopropan-2-yl]carbamoyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 87912942 |
| Molecular Formula | C25H17Cl2F2N3O4 |
| Molecular Weight | 532.33 g/mol |
| Exact Mass | 531.06 |
| IUPAC Name | 3,5-dichloro-4-[4-[[(2S)-1-[cyano(methyl)amino]-2-(2,6-difluorophenyl)-1-oxopropan-2-yl]carbamoyl]phenyl]benzoic acid |
| SMILES | CN(C#N)C(=O)[C@@](C)(NC(=O)c1ccc(-c2c(Cl)cc(C(=O)O)cc2Cl)cc1)c1c(F)cccc1F |
| InChI | InChI=1S/C25H17Cl2F2N3O4/c1-25(24(36)32(2)12-30,21-18(28)4-3-5-19(21)29)31-22(33)14-8-6-13(7-9-14)20-16(26)10-15(23(34)35)11-17(20)27/h3-11H,1-2H3,(H,31,33)(H,34,35)/t25-/m0/s1 |
| InChIKey | WGHKLYSRFHGOPV-VWLOTQADSA-N |
| XLogP | 5.22 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.33 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|