C25H38OSm — CID 87913141
2-methyl-2,3-bis(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)oxolane;samarium (PubChem CID 87913141) has the molecular formula C25H38OSm and a molecular weight of 504.94 g/mol. Its IUPAC name is 2-methyl-2,3-bis(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)oxolane;samarium.
| Compound Name | 2-methyl-2,3-bis(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)oxolane;samarium |
|---|---|
| PubChem CID | 87913141 |
| Molecular Formula | C25H38OSm |
| Molecular Weight | 504.94 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | 2-methyl-2,3-bis(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)oxolane;samarium |
| SMILES | CC1=C(C)C(C)(C)C(C2CCOC2(C)C2=C(C)C(C)=C(C)C2(C)C)=C1C.[Sm] |
| InChI | InChI=1S/C25H38O.Sm/c1-14-16(3)21(23(7,8)18(14)5)20-12-13-26-25(20,11)22-17(4)15(2)19(6)24(22,9)10;/h20H,12-13H2,1-11H3; |
| InChIKey | NPFDWONFCOYDGE-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.94 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |