About 2-ethyl-5,5-dihydroxypentanoic acid
2-ethyl-5,5-dihydroxypentanoic acid (PubChem CID 87913218) has the molecular formula C7H14O4
and a molecular weight of 162.19 g/mol. Its IUPAC name is 2-ethyl-5,5-dihydroxypentanoic acid.
Molecular Properties
| Compound Name | 2-ethyl-5,5-dihydroxypentanoic acid |
| PubChem CID | 87913218 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 2-ethyl-5,5-dihydroxypentanoic acid |
| SMILES | CCC(CCC(O)O)C(=O)O |
| InChI | InChI=1S/C7H14O4/c1-2-5(7(10)11)3-4-6(8)9/h5-6,8-9H,2-4H2,1H3,(H,10,11) |
| InChIKey | DVLIWYPJGBMJLK-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-5,5-dihydroxypentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5,5-dihydroxypentanoic acid?
The IUPAC name of 2-ethyl-5,5-dihydroxypentanoic acid (CID 87913218) is 2-ethyl-5,5-dihydroxypentanoic acid.
What is the SMILES notation for 2-ethyl-5,5-dihydroxypentanoic acid?
The canonical SMILES for 2-ethyl-5,5-dihydroxypentanoic acid is CCC(CCC(O)O)C(=O)O.
What is the InChIKey of 2-ethyl-5,5-dihydroxypentanoic acid?
The InChIKey is DVLIWYPJGBMJLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O4/c1-2-5(7(10)11)3-4-6(8)9/h5-6,8-9H,2-4H2,1H3,(H,10,11).
What are the key properties of 2-ethyl-5,5-dihydroxypentanoic acid?
2-ethyl-5,5-dihydroxypentanoic acid has a molecular weight of 162.19 g/mol, XLogP of 0.19, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5,5-dihydroxypentanoic acid is sourced from PubChem (CID 87913218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).